Details for 2-bromobutyric acid

2-bromobutyric acid
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
80-58-0 |
| EC NO: |
201-294-5 |
| Molecular Formula: |
C4H6BrO2 |
| Molecular Weight: |
165.9938 |
| Specification: |
|
| InChI: |
InChI=1/C4H7BrO2/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H,6,7)/p-1/t3-/m0/s1 |
| Synonyms: |
2-Bromobutanoic acid;alpha-Bromobutyric acid;2-bromo-butanoicaci;alpha-Bromobytyric acid;Butanoic acid, 2-bromo-;Butyric acid, 2-bromo-;Butyric acid, alpha-bromo-;dl-2-Bromobutyric acid;dl-2-Bromobutyricacid;α-Bromobutyricacid;(2S)-2-bromobutanoic acid;(2R)-2-bromobutanoate;(2S)-2-bromobutanoate;Bromobutyric; |
| Molecular Structure: |
 |
if you are sourcing 2-bromobutyric acid from China ,just feel free to inquire