Details for 4-Chlorocinnamic acid

4-Chlorocinnamic acid
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
1615-02-7 |
| EC NO: |
216-564-8 |
| Molecular Formula: |
C9H6ClO2 |
| Molecular Weight: |
181.5963 |
| Specification: |
|
| InChI: |
InChI=1/C9H7ClO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12)/p-1/b6-3+ |
| Synonyms: |
(2E)-3-(4-chlorophenyl)prop-2-enoic acid;4-Chlorophenyl acrylic acid;4-chlorocinnamic acid, predominantly trans;(2E)-3-(4-chlorophenyl)prop-2-enoate; |
| Molecular Structure: |
 |
if you are sourcing 4-Chlorocinnamic acid from China ,just feel free to inquire