Details for Butyl lactate

Butyl lactate
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
138-22-7 |
EC NO: |
205-316-4;252-036-3 |
Molecular Formula: |
C7H14O3 |
Molecular Weight: |
146.1843 |
Specification: |
98% 99% |
InChI: |
InChI=1/C7H14O3/c1-3-4-5-10-7(9)6(2)8/h6,8H,3-5H2,1-2H3/t6-/m0/s1 |
Synonyms: |
2-Propanoic Acid;Butyl 2-hydroxypropanoate;Butyl alpha-Hydroxypropionate;Butyl Lactate;Lactic Acid Butyl Ester; ;butyl (2R)-2-hydroxypropanoate;butyl (2S)-2-hydroxypropanoate;(-)-butyl L-lactate;n-Butyl (S)-(-)-2-hydroxypropionate;L-Lactic acid n-butyl ester;(R)-(-)-Butyllactat;Butyl L-Lactate; |
Molecular Structure: |
 |
if you are sourcing Butyl lactate from China ,just feel free to inquire