| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
99-82-1 |
| EC NO: |
202-790-4 |
| Molecular Formula: |
C10H20 |
| Molecular Weight: |
140.26 |
| Specification: |
|
| InChI: |
InChI=1/C10H20/c1-8(2)10-6-4-9(3)5-7-10/h8-10H,4-7H2,1-3H3 |
Product description:
| SPECIFICATIONS |
| Items |
Standard |
| Appearance |
Clear liquid |
| Density(d20/4) |
0.79-0.81 |
| Refractive index(N20/D) |
1.4370-1.4500
|
| Purity |
95% min
|
| p-cymene |
0.5% max |
| Application: raw material for p-menthane hydroperoxide, intermediate forspice,solvent. |
| packing: in iron drum plated with zinc of 165kgs net, 80 drums/20' |
|
| Synonyms: |
1-Isopropyl-4-Methyl Cyclohexane;p-Menthane;1-Methyl-4-iso-propylcyclohexane;4-menthane;paramenthane; |
| Molecular Structure: |
 |
CN
China Suppliers > sunyuanchem > 
Search Product