Details for H-Cys-OMe.HCl

H-Cys-OMe.HCl
| Category: |
Organic chemicals and Derivatives/Others |
|
| CAS NO: |
18598-63-5 |
| EC NO: |
242-435-0 |
| Molecular Formula: |
C4H10ClNO2S |
| Molecular Weight: |
171.6457 |
| Specification: |
|
| InChI: |
InChI=1/C4H9NO2S.ClH/c1-7-4(6)3(5)2-8;/h3,8H,2,5H2,1H3;1H/t3-;/m1./s1 |
Product description:
18598-63-5H-Cys-OMe.HCl
Quick Details
ProName: H-Cys-OMe.HCl CasNo: 18598-63-5 Application: up to kgs Purity: 98% LimitNum: 0
|
| Synonyms: |
H-Cys-OMe.HCl;Methyl cysteine hydrochloride;Visclair;methyl cysteinate hydrochloride (1:1);(2R)-1-methoxy-1-oxo-3-sulfanylpropan-2-aminium chloride;(2S)-1-methoxy-1-oxo-3-sulfanylpropan-2-aminium chloride;H-Cys-OMe·HCl; |
| Molecular Structure: |
 |
if you are sourcing H-Cys-OMe.HCl from China ,just feel free to inquire