Details for H-DL-Ala-OMe.HCl

H-DL-Ala-OMe.HCl
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
13515-97-4 |
| EC NO: |
236-854-8 |
| Molecular Formula: |
C4H10ClNO2 |
| Molecular Weight: |
139.5807 |
| Specification: |
|
| InChI: |
InChI=1/C4H9NO2.ClH/c1-3(5)4(6)7-2;/h3H,5H2,1-2H3;1H |
Product description:
13515-97-4H-DL-Ala-OMe.HCl
Quick Details
ProName: H-DL-Ala-OMe.HCl CasNo: 13515-97-4 DeliveryTime: Inquiry PackAge: 5g/tin; 250g/tin; 1kg/tin Port: Shanghai ProductionCapacity: 100 Kilogram/Month Purity: 99% LimitNum: 0 Metric Ton |
| Synonyms: |
DL-alanine methyl ester hcl;methyl L-alaninate hydrochloride;methyl alaninate hydrochloride;Methyl Dl-2-Aminopropanoate Hydrochloride;H-DL-Ala-OMe·HCl;H-DL-Ala-OMe•HCl; |
| Molecular Structure: |
 |
if you are sourcing H-DL-Ala-OMe.HCl from China ,just feel free to inquire