Details for H-beta-Ala-OMe.HCl

H-beta-Ala-OMe.HCl
| Category: |
Organic chemicals and Derivatives/Others |
|
| CAS NO: |
3196-73-4 |
| EC NO: |
|
| Molecular Formula: |
C4H10ClNO2 |
| Molecular Weight: |
139.5807 |
| Specification: |
|
| InChI: |
InChI=1/C4H9NO2.ClH/c1-7-4(6)2-3-5;/h2-3,5H2,1H3;1H |
Product description:
3196-73-4H-beta-Ala-OMe . HCl
Quick Details
ProName: H-beta-Ala-OMe . HCl CasNo: 3196-73-4 DeliveryTime: Inquiry PackAge: 5g/tin; 250g/tin; 1kg/tin Port: Shanghai ProductionCapacity: 100 Kilogram/Month Purity: 99% LimitNum: 0 Metric Ton |
| Synonyms: |
Methyl 3-aminopropionate hydrochloride;H-beta-Ala-OMe.HCl;H-beta-Ala-OMe . HCl;beta-Alanine Methyl Ester HCl;beta-Alanine Methylester;Beta-Alaine methyl ester hydrochloride;H-β-Ala-OMe.HCl;methyl beta-alaninate;3-methoxy-3-oxopropan-1-aminium;methyl beta-alaninate hydrochloride;3-Amino-propionic acid methyl ester.HCL;H-β-Ala-OMe·HCl;H-ß-Ala-OMe.HCl;Beta-Alaninemethyl Ester Hydrochloride;H-β-Ala-OMe; |
| Molecular Structure: |
 |
if you are sourcing H-beta-Ala-OMe.HCl from China ,just feel free to inquire