Details for Dicyclohexylketone

Dicyclohexylketone
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
119-60-8 |
| EC NO: |
204-336-0 |
| Molecular Formula: |
C13H22O |
| Molecular Weight: |
194.3132 |
| Specification: |
|
| InChI: |
InChI=1/C13H22O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2 |
| Packing: |
50 kg plastic drums |
| Synonyms: |
Methanone, dicyclohexyl-;4-07-00-00262 (Beilstein Handbook Reference);AI3-05564;BRN 1909406;Cyclohexane ketone;Ketone, dicyclohexyl;NSC 49725;Cyclohexyl ketone;dicyclohexylmethanone;dicyclohexyl-Methanone; |
| Molecular Structure: |
 |
if you are sourcing Dicyclohexylketone from Italy ,just feel free to inquire