Details for Transparent Orange 3G

Transparent Orange 3G
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
61969-47-9 |
| EC NO: |
230-049-5 |
| Molecular Formula: |
C18H10N2O |
| Molecular Weight: |
270.2848 |
| Specification: |
|
| InChI: |
InChI=1/C18H10N2O/c21-18-13-8-2-1-7-12(13)17-19-14-9-3-5-11-6-4-10-15(16(11)14)20(17)18/h1-10H |
| Synonyms: |
C.I.Solvent Orange 60;Solvent Orange 60;Orange 3G;12H-isoindolo[2,1-a]perimidin-12-one;12H-phthaloperin-12-one;C.I. Disperse Orange 24;C.I. Solvent Orange 60;C.I. Solvent Orange 78;Plast orange 2001;C.I. 564100; |
| Molecular Structure: |
 |
if you are sourcing Transparent Orange 3G from China ,just feel free to inquire