Details for 1-Methyl-5-nitro-1H-benzimidazole-2-butanoic acid ethyl ester

1-Methyl-5-nitro-1H-benzimidazole-2-butanoic acid ethyl ester
| Category: |
Intermediates |
|
| CAS NO: |
3543-72-4 |
| EC NO: |
|
| Molecular Formula: |
C14H17N3O4 |
| Molecular Weight: |
291.3025 |
| Specification: |
|
| InChI: |
InChI=1/C14H17N3O4/c1-3-21-14(18)6-4-5-13-15-11-9-10(17(19)20)7-8-12(11)16(13)2/h7-9H,3-6H2,1-2H3 |
| Synonyms: |
1-Methyl-5-nitro-1H-benzimidazole-2-butanoic acid ethyl ester; |
| Molecular Structure: |
 |
if you are sourcing 1-Methyl-5-nitro-1H-benzimidazole-2-butanoic acid ethyl ester from China ,just feel free to inquire