CAS No: 10-07-1, Chemical Name: (Z)-3-(3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl)-2-methyl-pro p-2-enoic acid
the physical and chemical property of 10-07-1, (Z)-3-(3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl)-2-methyl-pro p-2-enoic acid is provided by ChemNet.com
ChemNet > CAS > 10-07-1 (Z)-3-(3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl)-2-methyl-pro p-2-enoic acid
10-07-1 (Z)-3-(3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl)-2-methyl-pro p-2-enoic acid
product Name |
(Z)-3-(3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl)-2-methyl-pro p-2-enoic acid |
Synonyms |
(2Z)-3-(3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl)-2-methylprop-2-enoic acid |
Molecular Formula |
C15H22O2 |
Molecular Weight |
234.334 |
InChI |
InChI=1/C15H22O2/c1-9-4-6-12(8-11(3)15(16)17)14-10(2)5-7-13(9)14/h8-9,12-13H,4-7H2,1-3H3,(H,16,17)/b11-8- |
CAS Registry Number |
10-07-1 |
Molecular Structure |
|
Density |
1.06g/cm3 |
Boiling point |
374.5°C at 760 mmHg |
Refractive index |
1.528 |
Flash point |
274.2°C |
Vapour Pressur |
1.22E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
|
|