CAS No: 136471-78-8, Chemical Name: 2-bromo-1,3,4,6,7,8-hexachlorooxanthrene
the physical and chemical property of 136471-78-8, 2-bromo-1,3,4,6,7,8-hexachlorooxanthrene is provided by ChemNet.com
ChemNet > CAS > 136471-78-8 2-bromo-1,3,4,6,7,8-hexachlorooxanthrene
136471-78-8 2-bromo-1,3,4,6,7,8-hexachlorooxanthrene
| product Name |
2-bromo-1,3,4,6,7,8-hexachlorooxanthrene |
| Synonyms |
|
| Molecular Formula |
C12HBrCl6O2 |
| Molecular Weight |
469.7571 |
| InChI |
InChI=1/C12HBrCl6O2/c13-4-6(16)9(19)12-11(7(4)17)20-3-1-2(14)5(15)8(18)10(3)21-12/h1H |
| CAS Registry Number |
136471-78-8 |
| Molecular Structure |
|
| Density |
1.99g/cm3 |
| Boiling point |
518.1°C at 760 mmHg |
| Refractive index |
1.682 |
| Flash point |
267.1°C |
| Vapour Pressur |
2.53E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
