ChemNet > CAS > 14337-53-2 2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol
14337-53-2 2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol
product Name |
2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol |
Molecular Formula |
C15H17BrN4O |
Molecular Weight |
349.2257 |
InChI |
InChI=1/C15H17BrN4O/c1-3-20(4-2)12-6-7-13(14(21)9-12)18-19-15-8-5-11(16)10-17-15/h5-10H,3-4H2,1-2H3,(H,17,19) |
CAS Registry Number |
14337-53-2 |
EINECS |
238-286-6 |
Molecular Structure |
|
Density |
1.39g/cm3 |
Melting point |
157-160℃ |
Boiling point |
427.2°C at 760 mmHg |
Refractive index |
1.618 |
Flash point |
212.2°C |
Vapour Pressur |
1.67E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|