ChemNet > CAS > 182482-25-3 2,4,6-Trifluorobenzeneboronic acid
182482-25-3 2,4,6-Trifluorobenzeneboronic acid
| product Name |
2,4,6-Trifluorobenzeneboronic acid |
| Synonyms |
2,4,6-Trifluorophenylboronicacid; 2,4,6-Trifluorophenylboronic acid |
| Molecular Formula |
C6H4BF3O2 |
| Molecular Weight |
175.901 |
| InChI |
InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
| CAS Registry Number |
182482-25-3 |
| Molecular Structure |
|
| Density |
1.44g/cm3 |
| Melting point |
228-235℃ |
| Boiling point |
266°C at 760 mmHg |
| Refractive index |
1.465 |
| Flash point |
114.6°C |
| Vapour Pressur |
0.00444mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
