ChemNet > CAS > 19622-28-7 N-{4-[2,3-dihydroxy-3-(propan-2-ylamino)propoxy]phenyl}acetamide
19622-28-7 N-{4-[2,3-dihydroxy-3-(propan-2-ylamino)propoxy]phenyl}acetamide
| product Name |
N-{4-[2,3-dihydroxy-3-(propan-2-ylamino)propoxy]phenyl}acetamide |
| CAS No |
19622-28-7 |
| Synonyms |
|
| Molecular Formula |
C14H22N2O4 |
| Molecular Weight |
282.3355 |
| InChI |
InChI=1/C14H22N2O4/c1-9(2)15-14(19)13(18)8-20-12-6-4-11(5-7-12)16-10(3)17/h4-7,9,13-15,18-19H,8H2,1-3H3,(H,16,17) |
| Molecular Structure |
|
| Density |
1.206g/cm3 |
| Boiling point |
544.2°C at 760 mmHg |
| Refractive index |
1.571 |
| Flash point |
282.9°C |
| Vapour Pressur |
1.12E-12mmHg at 25°C |
|