ChemNet > CAS > 229-87-8 Phenanthridine
229-87-8 Phenanthridine
| product Name |
Phenanthridine |
| Synonyms |
Phenanthridine; 3,4-Benzoquinoline; Phenanthridine, (Benzo[c]quinoline) |
| Molecular Formula |
C13H9N |
| Molecular Weight |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
| CAS Registry Number |
229-87-8 |
| EINECS |
205-934-4 |
| Molecular Structure |
|
| Density |
1.187g/cm3 |
| Melting point |
104-107℃ |
| Boiling point |
340.8°C at 760 mmHg |
| Refractive index |
1.726 |
| Flash point |
155.9°C |
| Vapour Pressur |
0.000166mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
