ChemNet > CAS > 24937-79-9 poly(vinylidene fluoride)
24937-79-9 poly(vinylidene fluoride)
| product Name |
poly(vinylidene fluoride) |
| CAS No |
24937-79-9 |
| Synonyms |
Poly(vinylidene fluoride) (High M.Wt.); poly(1,1-difluoroethylene); PVDF; 1,1-difluoroethene |
| Molecular Formula |
C2H2F2 |
| Molecular Weight |
64.0341 |
| InChI |
InChI=1/C2H2F2/c1-2(3)4/h1H2 |
| EINECS |
200-867-7 |
| Molecular Structure |
|
| Density |
0.95g/cm3 |
| Refractive index |
1.264 |
| Vapour Pressur |
26200mmHg at 25°C |
| Safety Description |
S22:;
S24/25:;
|
|