ChemNet > CAS > 25115-74-6 4-Cyano-4-phenylcyclohexanone
25115-74-6 4-Cyano-4-phenylcyclohexanone
product Name |
4-Cyano-4-phenylcyclohexanone |
Synonyms |
4-oxo-1-phenylcyclohexanenitrile; 4-oxo-1-phenylcyclohexanecarbonitrile |
Molecular Formula |
C13H13NO |
Molecular Weight |
199.2484 |
InChI |
InChI=1/C13H13NO/c14-10-13(8-6-12(15)7-9-13)11-4-2-1-3-5-11/h1-5H,6-9H2 |
CAS Registry Number |
25115-74-6 |
EINECS |
246-631-7 |
Molecular Structure |
|
Density |
1.12g/cm3 |
Melting point |
114-119℃ |
Boiling point |
378.6°C at 760 mmHg |
Refractive index |
1.557 |
Flash point |
182.8°C |
Vapour Pressur |
6.22E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|