ChemNet > CAS > 25781-92-4 5-Chloro-2-nitrodiphenylamine
25781-92-4 5-Chloro-2-nitrodiphenylamine
| product Name |
5-Chloro-2-nitrodiphenylamine |
| Synonyms |
2-nitro-5-chlorodiphenyl amine; 5-chloro-2-nitro-N-phenylaniline |
| Molecular Formula |
C12H9ClN2O2 |
| Molecular Weight |
248.6651 |
| InChI |
InChI=1/C12H9ClN2O2/c13-9-6-7-12(15(16)17)11(8-9)14-10-4-2-1-3-5-10/h1-8,14H |
| CAS Registry Number |
25781-92-4 |
| EINECS |
247-261-9 |
| Molecular Structure |
|
| Density |
1.387g/cm3 |
| Melting point |
110-114℃ |
| Boiling point |
370.4°C at 760 mmHg |
| Refractive index |
1.671 |
| Flash point |
177.8°C |
| Vapour Pressur |
1.11E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
