ChemNet > CAS > 26426-80-2 poly(isobutylene-alt-maleic anhydride)
26426-80-2 poly(isobutylene-alt-maleic anhydride)
| product Name |
poly(isobutylene-alt-maleic anhydride) |
| Synonyms |
2,5-Furandione, polymer with 2-methyl-1-propene; 2-Methyl-1-propene, polymer with 2,5-furandione; Isobutylene/MA copolymer; Polyelectrolyte 60; Maleic anhydride, isobutylene copolymer; furan-2,5-dione - 2-methylprop-1-ene (1:1) |
| Molecular Formula |
C8H10O3 |
| Molecular Weight |
154.1632 |
| InChI |
InChI=1/C4H2O3.C4H8/c5-3-1-2-4(6)7-3;1-4(2)3/h1-2H;1H2,2-3H3 |
| CAS Registry Number |
26426-80-2 |
| Molecular Structure |
|
| Boiling point |
202°C at 760 mmHg |
| Flash point |
103.3°C |
| Vapour Pressur |
0.299mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
