ChemNet > CAS > 27129-86-8 3,5-Dimethylbenzylbromide
27129-86-8 3,5-Dimethylbenzylbromide
| product Name |
3,5-Dimethylbenzylbromide |
| CAS No |
27129-86-8 |
| Synonyms |
3,5-Dimethylbenzyl bromide; ALPHA-Bromomesitylene; 1-(bromomethyl)-3,5-dimethylbenzene |
| Molecular Formula |
C9H11Br |
| Molecular Weight |
199.0876 |
| InChI |
InChI=1/C9H11Br/c1-7-3-8(2)5-9(4-7)6-10/h3-5H,6H2,1-2H3 |
| EINECS |
212-529-6 |
| Molecular Structure |
|
| Density |
1.314g/cm3 |
| Melting point |
36-40℃ |
| Boiling point |
231.7°C at 760 mmHg |
| Refractive index |
1.554 |
| Flash point |
99°C |
| Vapour Pressur |
0.0934mmHg at 25°C |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R34:;
|
| Safety Description |
S26:;
S36/37/39:;
S45:;
|
| MSDS |
Material Safety Data Sheet
|
|