ChemNet > CAS > 27893-41-0 p-Heptyloxybenzaldehyde
27893-41-0 p-Heptyloxybenzaldehyde
| product Name |
p-Heptyloxybenzaldehyde |
| Synonyms |
4-n-Heptyloxybenzaldehyde; 4-heptyloxybenzaldehyde |
| Molecular Formula |
C14H20O2 |
| Molecular Weight |
220.3074 |
| InChI |
InChI=1/C14H20O2/c1-2-3-4-5-6-11-16-14-9-7-13(12-15)8-10-14/h7-10,12H,2-6,11H2,1H3 |
| CAS Registry Number |
27893-41-0 |
| EINECS |
248-714-3 |
| Molecular Structure |
|
| Density |
0.982g/cm3 |
| Boiling point |
334.7°C at 760 mmHg |
| Refractive index |
1.514 |
| Flash point |
138.6°C |
| Vapour Pressur |
0.000125mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
