ChemNet > CAS > 2893-05-2 3-Methyl-1-phenyl-2-butanone
2893-05-2 3-Methyl-1-phenyl-2-butanone
| product Name |
3-Methyl-1-phenyl-2-butanone |
| CAS No |
2893-05-2 |
| Synonyms |
Benzyl isopropyl ketone; 3-methyl-1-phenylbutan-2-one |
| Molecular Formula |
C11H14O |
| Molecular Weight |
162.2283 |
| InChI |
InChI=1/C11H14O/c1-9(2)11(12)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| EINECS |
220-765-6 |
| Molecular Structure |
|
| Density |
0.958g/cm3 |
| Boiling point |
237°C at 760 mmHg |
| Refractive index |
1.498 |
| Flash point |
93.2°C |
| Vapour Pressur |
0.0459mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
