3438-48-0 4-Phenylpyrimidine
| product Name |
4-Phenylpyrimidine |
| CAS No |
3438-48-0 |
| Synonyms |
4-Phenylpyrimidine; pyrimidine, 4-phenyl- |
| Molecular Formula |
C10H8N2 |
| Molecular Weight |
156.1839 |
| InChI |
InChI=1/C10H8N2/c1-2-4-9(5-3-1)10-6-7-11-8-12-10/h1-8H |
| EINECS |
222-345-8 |
| Molecular Structure |
|
| Density |
1.106g/cm3 |
| Melting point |
53-58℃ |
| Boiling point |
296.3°C at 760 mmHg |
| Refractive index |
1.58 |
| Flash point |
140.1°C |
| Vapour Pressur |
0.00256mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|