ChemNet > CAS > 3644-56-2 2-Chloro-N-(2,6-dichlorophenyl)-acetamide
3644-56-2 2-Chloro-N-(2,6-dichlorophenyl)-acetamide
| product Name |
2-Chloro-N-(2,6-dichlorophenyl)-acetamide |
| Synonyms |
2-Chloro-N-(2,6-dichlorophenyl)acetamide |
| Molecular Formula |
C8H6Cl3NO |
| Molecular Weight |
238.4983 |
| InChI |
InChI=1/C8H6Cl3NO/c9-4-7(13)12-8-5(10)2-1-3-6(8)11/h1-3H,4H2,(H,12,13) |
| CAS Registry Number |
3644-56-2 |
| EINECS |
222-874-4 |
| Molecular Structure |
|
| Density |
1.511g/cm3 |
| Melting point |
176-179℃ |
| Boiling point |
376.2°C at 760 mmHg |
| Refractive index |
1.616 |
| Flash point |
181.3°C |
| Vapour Pressur |
7.36E-06mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|
