ChemNet > CAS > 37529-27-4 4-heptylaniline
37529-27-4 4-heptylaniline
| product Name |
4-heptylaniline |
| Synonyms |
Heptylaniline; 4-n-Heptyaniline |
| Molecular Formula |
C13H21N |
| Molecular Weight |
191.3125 |
| InChI |
InChI=1/C13H21N/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
| CAS Registry Number |
37529-27-4 |
| Molecular Structure |
|
| Density |
0.923g/cm3 |
| Boiling point |
282.9°C at 760 mmHg |
| Refractive index |
1.522 |
| Flash point |
128.9°C |
| Vapour Pressur |
0.00327mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
