ChemNet > CAS > 37619-24-2 Methyl 1-methylpyrrole-2-carboxylate
37619-24-2 Methyl 1-methylpyrrole-2-carboxylate
| product Name |
Methyl 1-methylpyrrole-2-carboxylate |
| Synonyms |
1-Methylpyrrole-2-carboxylic acid methyl ester; methyl 1-methyl-1H-pyrrole-2-carboxylate |
| Molecular Formula |
C7H9NO2 |
| Molecular Weight |
139.1519 |
| InChI |
InChI=1/C7H9NO2/c1-8-5-3-4-6(8)7(9)10-2/h3-5H,1-2H3 |
| CAS Registry Number |
37619-24-2 |
| Molecular Structure |
|
| Density |
1.07g/cm3 |
| Boiling point |
204.7°C at 760 mmHg |
| Refractive index |
1.5 |
| Flash point |
77.6°C |
| Vapour Pressur |
0.26mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
