3937-28-8 Allyldichlorosilane
| product Name |
Allyldichlorosilane |
| CAS No |
3937-28-8 |
| Synonyms |
dichloro(prop-2-en-1-yl)silane; dichloro(prop-2-en-1-yl)silyl |
| Molecular Formula |
C3H5Cl2Si |
| Molecular Weight |
140.0633 |
| InChI |
InChI=1/C3H5Cl2Si/c1-2-3-6(4)5/h2H,1,3H2 |
| EINECS |
223-515-4 |
| Molecular Structure |
|
|