ChemNet > CAS > 3939-23-9 3-bromo-10H-phenothiazine
3939-23-9 3-bromo-10H-phenothiazine
| product Name |
3-bromo-10H-phenothiazine |
| CAS No |
3939-23-9 |
| Synonyms |
10H-phenothiazine, 3-bromo-; 3-Bromo-10H-phenothiazine |
| Molecular Formula |
C12H8BrNS |
| Molecular Weight |
278.1676 |
| InChI |
InChI=1/C12H8BrNS/c13-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)14-10/h1-7,14H |
| Molecular Structure |
|
| Density |
1.564g/cm3 |
| Boiling point |
410.5°C at 760 mmHg |
| Refractive index |
1.695 |
| Flash point |
202.1°C |
| Vapour Pressur |
5.99E-07mmHg at 25°C |
|