ChemNet > CAS > 39620-02-5 5-Bromonicotinoyl chloride
39620-02-5 5-Bromonicotinoyl chloride
| product Name |
5-Bromonicotinoyl chloride |
| Synonyms |
5-Bromopyridine-3-carbonyl chloride |
| Molecular Formula |
C6H3BrClNO |
| Molecular Weight |
220.4511 |
| InChI |
InChI=1/C6H3BrClNO/c7-5-1-4(6(8)10)2-9-3-5/h1-3H |
| CAS Registry Number |
39620-02-5 |
| Molecular Structure |
|
| Density |
1.76g/cm3 |
| Melting point |
75℃ |
| Boiling point |
265.4°C at 760 mmHg |
| Refractive index |
1.59 |
| Flash point |
114.3°C |
| Vapour Pressur |
0.00918mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
