CAS No: 4449-92-7, Chemical Name: 5-{(E)-[4-(diethylamino)phenyl]diazenyl}pyrimidine-2,4,6-triamine
the physical and chemical property of 4449-92-7, 5-{(E)-[4-(diethylamino)phenyl]diazenyl}pyrimidine-2,4,6-triamine is provided by ChemNet.com
ChemNet > CAS > 4449-92-7 5-{(E)-[4-(diethylamino)phenyl]diazenyl}pyrimidine-2,4,6-triamine
4449-92-7 5-{(E)-[4-(diethylamino)phenyl]diazenyl}pyrimidine-2,4,6-triamine
| product Name |
5-{(E)-[4-(diethylamino)phenyl]diazenyl}pyrimidine-2,4,6-triamine |
| Synonyms |
|
| Molecular Formula |
C14H20N8 |
| Molecular Weight |
300.3622 |
| InChI |
InChI=1/C14H20N8/c1-3-22(4-2)10-7-5-9(6-8-10)20-21-11-12(15)18-14(17)19-13(11)16/h5-8H,3-4H2,1-2H3,(H6,15,16,17,18,19)/b21-20+ |
| CAS Registry Number |
4449-92-7 |
| Molecular Structure |
![4449-92-7 5-{(E)-[4-(diethylamino)phenyl]diazenyl}pyrimidine-2,4,6-triamine](http://images-a.chemnet.com/suppliers/chembase/cas131/4449-92-7.png)
|
| Density |
1.37g/cm3 |
| Boiling point |
628.2°C at 760 mmHg |
| Refractive index |
1.687 |
| Flash point |
333.7°C |
| Vapour Pressur |
1.08E-15mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
