CAS No: 4647-42-1, Chemical Name: (1R,2S)-2,3-dihydro-1H-indene-1,2-diol
the physical and chemical property of 4647-42-1, (1R,2S)-2,3-dihydro-1H-indene-1,2-diol is provided by ChemNet.com
ChemNet > CAS > 4647-42-1 (1R,2S)-2,3-dihydro-1H-indene-1,2-diol
4647-42-1 (1R,2S)-2,3-dihydro-1H-indene-1,2-diol
| product Name |
(1R,2S)-2,3-dihydro-1H-indene-1,2-diol |
| Synonyms |
1H-Indene-1,2-diol, 2,3-dihydro-, cis-; cis-2,3-Dihydro-1H-indene-1,2-diol |
| Molecular Formula |
C9H10O2 |
| Molecular Weight |
150.1745 |
| InChI |
InChI=1/C9H10O2/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-11H,5H2/t8-,9+/m0/s1 |
| CAS Registry Number |
4647-42-1 |
| Molecular Structure |
|
| Density |
1.334g/cm3 |
| Boiling point |
288.5°C at 760 mmHg |
| Refractive index |
1.661 |
| Flash point |
142.8°C |
| Vapour Pressur |
0.00108mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
