ChemNet > CAS > 4651-97-2 2-amino-4-methylthiophene-3-carboxamide
4651-97-2 2-amino-4-methylthiophene-3-carboxamide
product Name |
2-amino-4-methylthiophene-3-carboxamide |
Molecular Formula |
C6H8N2OS |
Molecular Weight |
156.2055 |
InChI |
InChI=1/C6H8N2OS/c1-3-2-10-6(8)4(3)5(7)9/h2H,8H2,1H3,(H2,7,9) |
CAS Registry Number |
4651-97-2 |
Molecular Structure |
|
Density |
1.344g/cm3 |
Melting point |
173℃ |
Boiling point |
277.1°C at 760 mmHg |
Refractive index |
1.654 |
Flash point |
121.4°C |
Vapour Pressur |
0.00462mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|