50-42-0 adiphenine hydrochloride
| product Name |
adiphenine hydrochloride |
| CAS No |
50-42-0 |
| Synonyms |
2-(2,2-diphenylacetoxy)ethyldiethylammonium chloride; 2-diethylaminoethyl diphenylacetate hydrochloride; Adiphenine hydrochloride [USAN]; 2-(diethylamino)ethyl diphenylacetate hydrochloride (1:1) |
| Molecular Formula |
C20H26ClNO2 |
| Molecular Weight |
347.8789 |
| InChI |
InChI=1/C20H25NO2.ClH/c1-3-21(4-2)15-16-23-20(22)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-14,19H,3-4,15-16H2,1-2H3;1H |
| EINECS |
200-036-9 |
| Molecular Structure |
|
| Boiling point |
423°C at 760 mmHg |
| Flash point |
133.2°C |
| Vapour Pressur |
2.31E-07mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:;
|
| Safety Description |
S36:;
|
|