ChemNet > CAS > 505-54-4 Hexadecanedioic acid
505-54-4 Hexadecanedioic acid
product Name |
Hexadecanedioic acid |
Synonyms |
Thapsic acid; 1,16-Hexadecanedioic acid; Hexadecane Diacid; hexadecanedioate |
Molecular Formula |
C16H28O4 |
Molecular Weight |
284.3922 |
InChI |
InChI=1/C16H30O4/c17-15(18)13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(19)20/h1-14H2,(H,17,18)(H,19,20)/p-2 |
CAS Registry Number |
505-54-4 |
EINECS |
208-013-5 |
Molecular Structure |
|
Melting point |
120-123℃ |
Boiling point |
457.5°C at 760 mmHg |
Flash point |
244.6°C |
Vapour Pressur |
1.22E-09mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|