ChemNet > CAS > 506-24-1 stearolic acid
506-24-1 stearolic acid
product Name |
stearolic acid |
Synonyms |
Octadec-9-ynoic acid |
Molecular Formula |
C18H32O2 |
Molecular Weight |
280.4455 |
InChI |
InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-8,11-17H2,1H3,(H,19,20) |
CAS Registry Number |
506-24-1 |
EINECS |
208-030-8 |
Molecular Structure |
|
Density |
0.923g/cm3 |
Boiling point |
405.2°C at 760 mmHg |
Refractive index |
1.471 |
Flash point |
196.3°C |
Vapour Pressur |
1.07E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|