CAS No: 11030-86-7;534-47-4;77667-55-1, Chemical Name: (1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl 2-amino-2-deoxy-alpha-D-glucopyranoside
the physical and chemical property of 11030-86-7;534-47-4;77667-55-1, (1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl 2-amino-2-deoxy-alpha-D-glucopyranoside is provided by ChemNet.com
ChemNet > CAS > 11030-86-7;534-47-4;77667-55-1 (1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl 2-amino-2-deoxy-alpha-D-glucopyranoside
11030-86-7;534-47-4;77667-55-1 (1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl 2-amino-2-deoxy-alpha-D-glucopyranoside
| product Name |
(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl 2-amino-2-deoxy-alpha-D-glucopyranoside |
| Synonyms |
|
| Molecular Formula |
C12H25N3O7 |
| Molecular Weight |
323.3428 |
| InChI |
InChI=1/C12H25N3O7/c13-3-1-4(14)11(10(20)7(3)17)22-12-6(15)9(19)8(18)5(2-16)21-12/h3-12,16-20H,1-2,13-15H2/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-/m1/s1 |
| CAS Registry Number |
11030-86-7;534-47-4;77667-55-1 |
| Molecular Structure |
|
| Density |
1.56g/cm3 |
| Boiling point |
593.6°C at 760 mmHg |
| Refractive index |
1.651 |
| Flash point |
312.8°C |
| Vapour Pressur |
1.46E-16mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
