ChemNet > CAS > 56014-48-3 1-[2-(3,4-dimethoxyphenyl)ethyl]proline
56014-48-3 1-[2-(3,4-dimethoxyphenyl)ethyl]proline
| product Name |
1-[2-(3,4-dimethoxyphenyl)ethyl]proline |
| CAS No |
56014-48-3 |
| Synonyms |
|
| Molecular Formula |
C15H21NO4 |
| Molecular Weight |
279.3315 |
| InChI |
InChI=1/C15H21NO4/c1-19-13-6-5-11(10-14(13)20-2)7-9-16-8-3-4-12(16)15(17)18/h5-6,10,12H,3-4,7-9H2,1-2H3,(H,17,18) |
| Molecular Structure |
|
| Density |
1.172g/cm3 |
| Boiling point |
426.5°C at 760 mmHg |
| Refractive index |
1.544 |
| Flash point |
211.8°C |
| Vapour Pressur |
4.91E-08mmHg at 25°C |
|