ChemNet > CAS > 5773-80-8 6-bromo-2-naphthoic acid
5773-80-8 6-bromo-2-naphthoic acid
| product Name |
6-bromo-2-naphthoic acid |
| Synonyms |
2-naphthalenecarboxylic acid, 6-bromo-; 6-Bromo-2-naphthoicacid; 6-bromonaphthalene-2-carboxylic acid; 6-Bromo-2-naphthoicacid,96%; 6-BROMO-2-NAPHTHOIC ACID 99%; 6-bromo-2-Naphthalenecarboxylic acid |
| Molecular Formula |
C11H7BrO2 |
| Molecular Weight |
251.0761 |
| InChI |
InChI=1/C11H7BrO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,(H,13,14) |
| CAS Registry Number |
5773-80-8 |
| Molecular Structure |
|
| Density |
1.648g/cm3 |
| Melting point |
294-295℃ |
| Boiling point |
387.3°C at 760 mmHg |
| Refractive index |
1.697 |
| Flash point |
188°C |
| Vapour Pressur |
1.08E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
