ChemNet > CAS > 62438-03-3 5-Methylisoxazole-3-carboxylic acid hydrazide
62438-03-3 5-Methylisoxazole-3-carboxylic acid hydrazide
| product Name |
5-Methylisoxazole-3-carboxylic acid hydrazide |
| Synonyms |
5-methyl-1,2-oxazole-3-carbohydrazide |
| Molecular Formula |
C5H7N3O2 |
| Molecular Weight |
141.128 |
| InChI |
InChI=1/C5H7N3O2/c1-3-2-4(8-10-3)5(9)7-6/h2H,6H2,1H3,(H,7,9) |
| CAS Registry Number |
62438-03-3 |
| Molecular Structure |
|
| Density |
1.291g/cm3 |
| Refractive index |
1.534 |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
