CAS No: 67205-69-0, Chemical Name: 2-(diethylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile
the physical and chemical property of 67205-69-0, 2-(diethylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile is provided by ChemNet.com
ChemNet > CAS > 67205-69-0 2-(diethylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile
67205-69-0 2-(diethylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile
| product Name |
2-(diethylamino)-3,5,6-trifluorobenzene-1,4-dicarbonitrile |
| Synonyms |
|
| Molecular Formula |
C12H10F3N3 |
| Molecular Weight |
253.2231 |
| InChI |
InChI=1/C12H10F3N3/c1-3-18(4-2)12-8(6-17)10(14)9(13)7(5-16)11(12)15/h3-4H2,1-2H3 |
| CAS Registry Number |
67205-69-0 |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Boiling point |
358.2°C at 760 mmHg |
| Refractive index |
1.51 |
| Flash point |
170.4°C |
| Vapour Pressur |
2.59E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
