ChemNet > CAS > 68708-83-8 5-fluoro-2-(4-fluorophenyl)-3-(2-morpholin-4-ylethyl)-1H-indole
68708-83-8 5-fluoro-2-(4-fluorophenyl)-3-(2-morpholin-4-ylethyl)-1H-indole
| product Name |
5-fluoro-2-(4-fluorophenyl)-3-(2-morpholin-4-ylethyl)-1H-indole |
| CAS No |
68708-83-8 |
| Synonyms |
|
| Molecular Formula |
C20H20F2N2O |
| Molecular Weight |
342.3824 |
| InChI |
InChI=1/C20H20F2N2O/c21-15-3-1-14(2-4-15)20-17(7-8-24-9-11-25-12-10-24)18-13-16(22)5-6-19(18)23-20/h1-6,13,23H,7-12H2 |
| Molecular Structure |
|
| Density |
1.254g/cm3 |
| Boiling point |
515.4°C at 760 mmHg |
| Refractive index |
1.607 |
| Flash point |
265.5°C |
| Vapour Pressur |
9.88E-11mmHg at 25°C |
|