ChemNet > CAS > 71923-04-1 4-{2-[4-(3,5-dichlorophenyl)piperazin-1-yl]ethyl}-5-(4-fluorophenyl)-1,3-dioxol-2-one hydrochloride
71923-04-1 4-{2-[4-(3,5-dichlorophenyl)piperazin-1-yl]ethyl}-5-(4-fluorophenyl)-1,3-dioxol-2-one hydrochloride
| product Name |
4-{2-[4-(3,5-dichlorophenyl)piperazin-1-yl]ethyl}-5-(4-fluorophenyl)-1,3-dioxol-2-one hydrochloride |
| CAS No |
71923-04-1 |
| Synonyms |
|
| Molecular Formula |
C21H20Cl3FN2O3 |
| Molecular Weight |
473.7525 |
| InChI |
InChI=1/C21H19Cl2FN2O3.ClH/c22-15-11-16(23)13-18(12-15)26-9-7-25(8-10-26)6-5-19-20(29-21(27)28-19)14-1-3-17(24)4-2-14;/h1-4,11-13H,5-10H2;1H |
| Molecular Structure |
|
| Boiling point |
565.6°C at 760 mmHg |
| Flash point |
295.9°C |
| Vapour Pressur |
8.2E-13mmHg at 25°C |
|