ChemNet > CAS > 98437-24-2 Benzo(b)furan-2-boronic acid
98437-24-2 Benzo(b)furan-2-boronic acid
| product Name |
Benzo(b)furan-2-boronic acid |
| CAS No |
98437-24-2 |
| Synonyms |
Benzofuran-2-boronic acid; Benzo[b]furan-2-boronic acid; 1-Benzofuran-2-ylboronic acid; Benzofuran-2-ylboronic acid |
| Molecular Formula |
C8H7BO3 |
| Molecular Weight |
161.9504 |
| InChI |
InChI=1/C8H7BO3/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5,10-11H |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Melting point |
114-116℃ |
| Boiling point |
340.4°C at 760 mmHg |
| Refractive index |
1.618 |
| Flash point |
159.7°C |
| Vapour Pressur |
3.33E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
