Details for Deca Bromo Diphenyl Oxide
Deca Bromo Diphenyl Oxide
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
1163-19-5 |
EC NO: |
214-604-9 |
Molecular Formula: |
C10Br10O |
Molecular Weight: |
959.17 |
Specification: |
|
InChI: |
InChI:1S/C12Br10O/c13-1-3(15)7(19)11(8(20)4(1)16)23-12-9(21)5(17)2(14)6(18)10(12)22 |
Synonyms: |
DBDPO;Decabromodiphenyl ether;Bis(pentabromophenyl) ether;Decabromodiphenyl Oxide;SynaPro S12;1,1'-oxybis(pentabromobenzene);DECABROMDIPHENYL OXIDE; |
Molecular Structure: |
|
if you are sourcing Deca Bromo Diphenyl Oxide from Australia ,just feel free to inquire