Details for 2-Carboxyphenylboronic acid
![](/images/home/newal1.gif)
2-Carboxyphenylboronic acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
149105-19-1 |
EC NO: |
|
Molecular Formula: |
C7H7BO4 |
Molecular Weight: |
165.9391 |
Specification: |
|
InChI: |
InChI=1/C7H7BO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,11-12H,(H,9,10) |
Synonyms: |
2-Boronobenzoic acid;2-Carboxybenzeneboronic acid;(2-DIHYDROXYBORONYL)BENZOIC ACID;2-(DIHYDROXYBORYL)BENZOIC ACID;RARECHEM AH PB 0146;O-CARBOXYPHENYLBORONIC ACID;2-CarboxyphenylboronicAcid;2-(dihydroxyboranyl)benzoic acid; |
Molecular Structure: |
![2-Carboxyphenylboronic acid 149105-19-1](https://images-a.chemnet.com/suppliers/chembase/cas/cas149105-19-1.gif) |
if you are sourcing 2-Carboxyphenylboronic acid from Australia ,just feel free to inquire