Details for 1-chloroethyl ethyl carbonate
1-chloroethyl ethyl carbonate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
50893-36-2 |
EC NO: |
256-832-1 |
Molecular Formula: |
C5H9ClO3 |
Molecular Weight: |
152.5762 |
Specification: |
|
InChI: |
InChI=1/C5H9ClO3/c1-3-8-5(7)9-4(2)6/h4H,3H2,1-2H3/t4-/m1/s1 |
Synonyms: |
1-Chloroethylethylcarbonate;Carbonic acid 1-chloroethyl ethyl ester;(1R)-1-chloroethyl ethyl carbonate;(1S)-1-chloroethyl ethyl carbonate; |
Molecular Structure: |
|
if you are sourcing 1-chloroethyl ethyl carbonate from Belgium ,just feel free to inquire