111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
58-61-7 |
EC NO: |
200-389-9 |
Molecular Formula: |
C10H13N5O4 |
Molecular Weight: |
267.2413 |
Specification: |
|
InChI: |
InChI=1/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6+,7+,10+/m1/s1 |
Product description:
Pharmaceutical industry is mainly used to produce, sugar, adenosine, Adenosine triphosphate, Coenzyme and series products of the drug ring adenosine triphosphate, etc;Used for making ATP, sugar, adenosine, coenzyme A etc |
Synonyms: |
adenosine free base;6-Amino-9-(beta-D-ribofuranosyl)9H-purine;9-alpha-D-lyxofuranosyl-9H-purin-6-amine;AR; |
Molecular Structure: |
 |