Details for Amyl Acetate
Amyl Acetate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
628-63-7 |
EC NO: |
211-047-3 |
Molecular Formula: |
C7H14O2 |
Molecular Weight: |
130.1849 |
Specification: |
|
InChI: |
InChI=1/C7H14O2/c1-3-4-5-6-9-7(2)8/h3-6H2,1-2H3 |
Synonyms: |
n-Amyl acetate;Amyl Acetate (mixed isomers);Acetic acid n-pentyl ester;n-Amyl acetate;Acetic Acid n-Amyl Ester;pentyl acetate;Amyl acetate;Nitrocellulose lacquer thinner;Acetic ester; |
Molecular Structure: |
|
if you are sourcing Amyl Acetate from Canada ,just feel free to inquire