Details for 2-Bromo-2-(2-chlorophenyl) acetic acid
![](/images/home/newal1.gif)
2-Bromo-2-(2-chlorophenyl) acetic acid
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
141109-25-3 |
EC NO: |
|
Molecular Formula: |
C8H6BrClO2 |
Molecular Weight: |
249.489 |
Specification: |
|
InChI: |
InChI=1/C8H6BrClO2/c9-7(8(11)12)5-3-1-2-4-6(5)10/h1-4,7H,(H,11,12) |
Synonyms: |
Alpha-Bromo-(2-Chloro)Phenylacetic Acid;2-Bromo-2-Chlorophenylacetic Acid;bromo(2-chlorophenyl)acetic acid;Alpha Bromo 2-Chloro Phenyl Acetci Acid;bromo-(2-chloro-phenyl)-acetic acid;2-Bromo-2-(2-chlorophenyl)acetic acid; |
Molecular Structure: |
![2-Bromo-2-(2-chlorophenyl) acetic acid 141109-25-3](https://images-a.chemnet.com/suppliers/chembase/179/179111_1.gif) |
if you are sourcing 2-Bromo-2-(2-chlorophenyl) acetic acid from Canada ,just feel free to inquire